About 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide
1-methylpyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 141014223) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide |
| PubChem CID | 141014223 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | Cn1ccc2cc(C(N)=O)cnc21 |
| InChI | InChI=1S/C9H9N3O/c1-12-3-2-6-4-7(8(10)13)5-11-9(6)12/h2-5H,1H3,(H2,10,13) |
| InChIKey | SBLUINDSGZFENQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide?
The IUPAC name of 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide (CID 141014223) is 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide.
What is the SMILES notation for 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide?
The canonical SMILES for 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide is Cn1ccc2cc(C(N)=O)cnc21.
What is the InChIKey of 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide?
The InChIKey is SBLUINDSGZFENQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-12-3-2-6-4-7(8(10)13)5-11-9(6)12/h2-5H,1H3,(H2,10,13).
What are the key properties of 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide?
1-methylpyrrolo[2,3-b]pyridine-5-carboxamide has a molecular weight of 175.19 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolo[2,3-b]pyridine-5-carboxamide is sourced from PubChem (CID 141014223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).