About (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol
(5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol (PubChem CID 141014401) has the molecular formula C10H12FNO
and a molecular weight of 181.21 g/mol. Its IUPAC name is (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol.
Molecular Properties
| Compound Name | (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol |
| PubChem CID | 141014401 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol |
| SMILES | CC[C@]1(O)CCc2c1ccnc2F |
| InChI | InChI=1S/C10H12FNO/c1-2-10(13)5-3-7-8(10)4-6-12-9(7)11/h4,6,13H,2-3,5H2,1H3/t10-/m0/s1 |
| InChIKey | QLDZCIFONWLCRK-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol?
The IUPAC name of (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol (CID 141014401) is (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol.
What is the SMILES notation for (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol?
The canonical SMILES for (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol is CC[C@]1(O)CCc2c1ccnc2F.
What is the InChIKey of (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol?
The InChIKey is QLDZCIFONWLCRK-JTQLQIEISA-N. The full InChI is InChI=1S/C10H12FNO/c1-2-10(13)5-3-7-8(10)4-6-12-9(7)11/h4,6,13H,2-3,5H2,1H3/t10-/m0/s1.
What are the key properties of (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol?
(5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol has a molecular weight of 181.21 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-ethyl-1-fluoro-6,7-dihydrocyclopenta[c]pyridin-5-ol is sourced from PubChem (CID 141014401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).