C6H8BF5N2O2 — CID 141014578
diazanium;dioxido-(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 141014578) has the molecular formula C6H8BF5N2O2 and a molecular weight of 245.94 g/mol. Its IUPAC name is diazanium;dioxido-(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | diazanium;dioxido-(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 141014578 |
| Molecular Formula | C6H8BF5N2O2 |
| Molecular Weight | 245.94 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | diazanium;dioxido-(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | [NH4+].[NH4+].[O-]B([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6BF5O2.2H3N/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;;/h;2*1H3/q-2;;/p+2 |
| InChIKey | BULAZTGREHQGQS-UHFFFAOYSA-P |
| XLogP | -0.45 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.94 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|