About 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide
3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 141014726) has the molecular formula C13H12F2N2O2S
and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide |
| PubChem CID | 141014726 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | CCc1ccc(COc2nscc2C(N)=O)c(F)c1F |
| InChI | InChI=1S/C13H12F2N2O2S/c1-2-7-3-4-8(11(15)10(7)14)5-19-13-9(12(16)18)6-20-17-13/h3-4,6H,2,5H2,1H3,(H2,16,18) |
| InChIKey | JWIWQAXZICUFOL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide (CID 141014726) is 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide is CCc1ccc(COc2nscc2C(N)=O)c(F)c1F.
What is the InChIKey of 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide?
The InChIKey is JWIWQAXZICUFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2O2S/c1-2-7-3-4-8(11(15)10(7)14)5-19-13-9(12(16)18)6-20-17-13/h3-4,6H,2,5H2,1H3,(H2,16,18).
What are the key properties of 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide?
3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide has a molecular weight of 298.31 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-2,3-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 141014726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).