C16H24O4 — CID 141014817
[2-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetyl] 2-methylprop-2-enoate (PubChem CID 141014817) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [2-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141014817 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [2-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C[C@]1(O)C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C16H24O4/c1-10(2)13(18)20-12(17)9-16(19)8-11-6-7-15(16,5)14(11,3)4/h11,19H,1,6-9H2,2-5H3/t11-,15-,16-/m1/s1 |
| InChIKey | VNNKWCBXRRPPHX-HFBAOOFYSA-N |
| XLogP | 2.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|