About 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide
2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide (PubChem CID 141015010) has the molecular formula C9H11F3N4O3
and a molecular weight of 280.21 g/mol. Its IUPAC name is 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide.
Molecular Properties
| Compound Name | 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide |
| PubChem CID | 141015010 |
| Molecular Formula | C9H11F3N4O3 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide |
| SMILES | NC(=O)CNCCn1c(=O)[nH]cc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C9H11F3N4O3/c10-9(11,12)5-3-15-8(19)16(7(5)18)2-1-14-4-6(13)17/h3,14H,1-2,4H2,(H2,13,17)(H,15,19) |
| InChIKey | IMFAXSJLXMFBPF-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide?
The IUPAC name of 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide (CID 141015010) is 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide.
What is the SMILES notation for 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide?
The canonical SMILES for 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide is NC(=O)CNCCn1c(=O)[nH]cc(C(F)(F)F)c1=O.
What is the InChIKey of 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide?
The InChIKey is IMFAXSJLXMFBPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N4O3/c10-9(11,12)5-3-15-8(19)16(7(5)18)2-1-14-4-6(13)17/h3,14H,1-2,4H2,(H2,13,17)(H,15,19).
What are the key properties of 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide?
2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide has a molecular weight of 280.21 g/mol, XLogP of -1.37, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide is sourced from PubChem (CID 141015010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).