About 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane
4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane (PubChem CID 141015062) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane.
Molecular Properties
| Compound Name | 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane |
| PubChem CID | 141015062 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane |
| SMILES | COCC(C(C)C)C(CC(C)C)OC |
| InChI | InChI=1S/C12H26O2/c1-9(2)7-12(14-6)11(8-13-5)10(3)4/h9-12H,7-8H2,1-6H3 |
| InChIKey | FYRZYGDPRKREPR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane?
The IUPAC name of 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane (CID 141015062) is 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane.
What is the SMILES notation for 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane?
The canonical SMILES for 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane is COCC(C(C)C)C(CC(C)C)OC.
What is the InChIKey of 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane?
The InChIKey is FYRZYGDPRKREPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-9(2)7-12(14-6)11(8-13-5)10(3)4/h9-12H,7-8H2,1-6H3.
What are the key properties of 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane?
4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane has a molecular weight of 202.34 g/mol, XLogP of 2.97, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-(methoxymethyl)-2,6-dimethylheptane is sourced from PubChem (CID 141015062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).