About 2-(1,3-dioxol-2-yl)-1,4-dioxane
2-(1,3-dioxol-2-yl)-1,4-dioxane (PubChem CID 141015106) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 2-(1,3-dioxol-2-yl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(1,3-dioxol-2-yl)-1,4-dioxane |
| PubChem CID | 141015106 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-(1,3-dioxol-2-yl)-1,4-dioxane |
| SMILES | C1=COC(C2COCCO2)O1 |
| InChI | InChI=1S/C7H10O4/c1-2-9-6(5-8-1)7-10-3-4-11-7/h3-4,6-7H,1-2,5H2 |
| InChIKey | OBQMELFBOFAQFK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxol-2-yl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxol-2-yl)-1,4-dioxane?
The IUPAC name of 2-(1,3-dioxol-2-yl)-1,4-dioxane (CID 141015106) is 2-(1,3-dioxol-2-yl)-1,4-dioxane.
What is the SMILES notation for 2-(1,3-dioxol-2-yl)-1,4-dioxane?
The canonical SMILES for 2-(1,3-dioxol-2-yl)-1,4-dioxane is C1=COC(C2COCCO2)O1.
What is the InChIKey of 2-(1,3-dioxol-2-yl)-1,4-dioxane?
The InChIKey is OBQMELFBOFAQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-2-9-6(5-8-1)7-10-3-4-11-7/h3-4,6-7H,1-2,5H2.
What are the key properties of 2-(1,3-dioxol-2-yl)-1,4-dioxane?
2-(1,3-dioxol-2-yl)-1,4-dioxane has a molecular weight of 158.15 g/mol, XLogP of 0.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxol-2-yl)-1,4-dioxane is sourced from PubChem (CID 141015106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).