C10H15N3 — CID 141015153
3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboximidamide (PubChem CID 141015153) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | 3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 141015153 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC2CC=CC=C2C1 |
| InChI | InChI=1S/C10H15N3/c11-10(12)13-6-5-8-3-1-2-4-9(8)7-13/h1-2,4,8H,3,5-7H2,(H3,11,12) |
| InChIKey | BWGJYZKMEPLKPB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|