C14H22O3 — CID 141015451
2-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]prop-2-enoic acid (PubChem CID 141015451) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141015451 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]prop-2-enoic acid |
| SMILES | C=C(C[C@]1(O)C[C@H]2CC[C@]1(C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C14H22O3/c1-9(11(15)16)7-14(17)8-10-5-6-13(14,4)12(10,2)3/h10,17H,1,5-8H2,2-4H3,(H,15,16)/t10-,13-,14+/m1/s1 |
| InChIKey | JIJJABXFGZILDB-HONMWMINSA-N |
| XLogP | 2.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|