C20H23Br2N3 — CID 141015690
N-[(3,5-dibromo-4-methylphenyl)methyl]-N'-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine (PubChem CID 141015690) has the molecular formula C20H23Br2N3 and a molecular weight of 465.23 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methylphenyl)methyl]-N'-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine.
| Compound Name | N-[(3,5-dibromo-4-methylphenyl)methyl]-N'-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 141015690 |
| Molecular Formula | C20H23Br2N3 |
| Molecular Weight | 465.23 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | N-[(3,5-dibromo-4-methylphenyl)methyl]-N'-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine |
| SMILES | Cc1c(Br)cc(CNCCCNC2C=Cc3ccccc3N2)cc1Br |
| InChI | InChI=1S/C20H23Br2N3/c1-14-17(21)11-15(12-18(14)22)13-23-9-4-10-24-20-8-7-16-5-2-3-6-19(16)25-20/h2-3,5-8,11-12,20,23-25H,4,9-10,13H2,1H3 |
| InChIKey | FJMGYABPDYDEET-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|