C28H31O2P — CID 141016646
[phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl]-(2,3,4,6-tetramethylphenyl)methanone (PubChem CID 141016646) has the molecular formula C28H31O2P and a molecular weight of 430.53 g/mol. Its IUPAC name is [phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl]-(2,3,4,6-tetramethylphenyl)methanone.
| Compound Name | [phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl]-(2,3,4,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 141016646 |
| Molecular Formula | C28H31O2P |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl]-(2,3,4,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(C(=O)c2c(C)cc(C)c(C)c2C)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C28H31O2P/c1-16-14-18(3)25(22(7)20(16)5)27(29)31(24-12-10-9-11-13-24)28(30)26-19(4)15-17(2)21(6)23(26)8/h9-15H,1-8H3 |
| InChIKey | HWMLIUVZAZTBAP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|