C27H23F6O2P — CID 141016659
[[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphanyl]-(2,3,4,5,6-pentamethylphenyl)methanone (PubChem CID 141016659) has the molecular formula C27H23F6O2P and a molecular weight of 524.44 g/mol. Its IUPAC name is [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphanyl]-(2,3,4,5,6-pentamethylphenyl)methanone.
| Compound Name | [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphanyl]-(2,3,4,5,6-pentamethylphenyl)methanone |
|---|---|
| PubChem CID | 141016659 |
| Molecular Formula | C27H23F6O2P |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphanyl]-(2,3,4,5,6-pentamethylphenyl)methanone |
| SMILES | Cc1c(C)c(C)c(C(=O)P(C(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C27H23F6O2P/c1-14-15(2)17(4)22(18(5)16(14)3)24(34)36(19-10-7-6-8-11-19)25(35)23-20(26(28,29)30)12-9-13-21(23)27(31,32)33/h6-13H,1-5H3 |
| InChIKey | KDZQVIFSWDGKCT-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|