C34H28N2O3 — CID 141017154
3,4-diphenyl-N-[(3-phenylmethoxyphenyl)methylcarbamoyl]benzamide (PubChem CID 141017154) has the molecular formula C34H28N2O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is 3,4-diphenyl-N-[(3-phenylmethoxyphenyl)methylcarbamoyl]benzamide.
| Compound Name | 3,4-diphenyl-N-[(3-phenylmethoxyphenyl)methylcarbamoyl]benzamide |
|---|---|
| PubChem CID | 141017154 |
| Molecular Formula | C34H28N2O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 3,4-diphenyl-N-[(3-phenylmethoxyphenyl)methylcarbamoyl]benzamide |
| SMILES | O=C(NCc1cccc(OCc2ccccc2)c1)NC(=O)c1ccc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C34H28N2O3/c37-33(29-19-20-31(27-14-6-2-7-15-27)32(22-29)28-16-8-3-9-17-28)36-34(38)35-23-26-13-10-18-30(21-26)39-24-25-11-4-1-5-12-25/h1-22H,23-24H2,(H2,35,36,37,38) |
| InChIKey | YBKKVFPMOLSCIY-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |