About 6H-benzo[a]carbazole
6H-benzo[a]carbazole (PubChem CID 141017182) has the molecular formula C16H11N
and a molecular weight of 217.27 g/mol. Its IUPAC name is 6H-benzo[a]carbazole.
Molecular Properties
| Compound Name | 6H-benzo[a]carbazole |
| PubChem CID | 141017182 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6H-benzo[a]carbazole |
| SMILES | C1=c2ccccc2=C2N=c3ccccc3=C2C1 |
| InChI | InChI=1S/C16H11N/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-9H,10H2 |
| InChIKey | WQFGZHAQYPXCOF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6H-benzo[a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-benzo[a]carbazole?
The IUPAC name of 6H-benzo[a]carbazole (CID 141017182) is 6H-benzo[a]carbazole.
What is the SMILES notation for 6H-benzo[a]carbazole?
The canonical SMILES for 6H-benzo[a]carbazole is C1=c2ccccc2=C2N=c3ccccc3=C2C1.
What is the InChIKey of 6H-benzo[a]carbazole?
The InChIKey is WQFGZHAQYPXCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-9H,10H2.
What are the key properties of 6H-benzo[a]carbazole?
6H-benzo[a]carbazole has a molecular weight of 217.27 g/mol, XLogP of 0.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-benzo[a]carbazole is sourced from PubChem (CID 141017182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).