C5H6N2O3 — CID 141017514
1,2,3,7a-tetrahydroimidazo[1,2-c][1,3]oxazole-5,7-dione (PubChem CID 141017514) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is 1,2,3,7a-tetrahydroimidazo[1,2-c][1,3]oxazole-5,7-dione.
| Compound Name | 1,2,3,7a-tetrahydroimidazo[1,2-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 141017514 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 1,2,3,7a-tetrahydroimidazo[1,2-c][1,3]oxazole-5,7-dione |
| SMILES | O=C1OC(=O)N2CCNC12 |
| InChI | InChI=1S/C5H6N2O3/c8-4-3-6-1-2-7(3)5(9)10-4/h3,6H,1-2H2 |
| InChIKey | DOIGWJZXWNMSSC-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|