About 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide
2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide (PubChem CID 141017761) has the molecular formula C11H13NO5S2
and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide.
Molecular Properties
| Compound Name | 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide |
| PubChem CID | 141017761 |
| Molecular Formula | C11H13NO5S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide |
| SMILES | C=NC(=O)c1cc(S(C)(=O)=O)c(S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C11H13NO5S2/c1-7-5-9(18(3,14)15)10(19(4,16)17)6-8(7)11(13)12-2/h5-6H,2H2,1,3-4H3 |
| InChIKey | QWVNNJFEZVMLJB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide?
The IUPAC name of 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide (CID 141017761) is 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide.
What is the SMILES notation for 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide?
The canonical SMILES for 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide is C=NC(=O)c1cc(S(C)(=O)=O)c(S(C)(=O)=O)cc1C.
What is the InChIKey of 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide?
The InChIKey is QWVNNJFEZVMLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5S2/c1-7-5-9(18(3,14)15)10(19(4,16)17)6-8(7)11(13)12-2/h5-6H,2H2,1,3-4H3.
What are the key properties of 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide?
2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide has a molecular weight of 303.36 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-methylidene-4,5-bis(methylsulfonyl)benzamide is sourced from PubChem (CID 141017761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).