C12H12O3 — CID 141017782
10-but-1-enyl-2,9-dioxatricyclo[5.3.0.01,3]deca-4,6-dien-8-one (PubChem CID 141017782) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 10-but-1-enyl-2,9-dioxatricyclo[5.3.0.01,3]deca-4,6-dien-8-one.
| Compound Name | 10-but-1-enyl-2,9-dioxatricyclo[5.3.0.01,3]deca-4,6-dien-8-one |
|---|---|
| PubChem CID | 141017782 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 10-but-1-enyl-2,9-dioxatricyclo[5.3.0.01,3]deca-4,6-dien-8-one |
| SMILES | CCC=CC1OC(=O)C2=CC=CC3OC213 |
| InChI | InChI=1S/C12H12O3/c1-2-3-6-9-12-8(11(13)14-9)5-4-7-10(12)15-12/h3-7,9-10H,2H2,1H3 |
| InChIKey | WIYBMRHLPHENFJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|