About 4-chloro-2-propylbenzoyl chloride
4-chloro-2-propylbenzoyl chloride (PubChem CID 141018159) has the molecular formula C10H10Cl2O
and a molecular weight of 217.09 g/mol. Its IUPAC name is 4-chloro-2-propylbenzoyl chloride.
Molecular Properties
| Compound Name | 4-chloro-2-propylbenzoyl chloride |
| PubChem CID | 141018159 |
| Molecular Formula | C10H10Cl2O |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 4-chloro-2-propylbenzoyl chloride |
| SMILES | CCCc1cc(Cl)ccc1C(=O)Cl |
| InChI | InChI=1S/C10H10Cl2O/c1-2-3-7-6-8(11)4-5-9(7)10(12)13/h4-6H,2-3H2,1H3 |
| InChIKey | URTFVBAJVVHCLO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-propylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-propylbenzoyl chloride?
The IUPAC name of 4-chloro-2-propylbenzoyl chloride (CID 141018159) is 4-chloro-2-propylbenzoyl chloride.
What is the SMILES notation for 4-chloro-2-propylbenzoyl chloride?
The canonical SMILES for 4-chloro-2-propylbenzoyl chloride is CCCc1cc(Cl)ccc1C(=O)Cl.
What is the InChIKey of 4-chloro-2-propylbenzoyl chloride?
The InChIKey is URTFVBAJVVHCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O/c1-2-3-7-6-8(11)4-5-9(7)10(12)13/h4-6H,2-3H2,1H3.
What are the key properties of 4-chloro-2-propylbenzoyl chloride?
4-chloro-2-propylbenzoyl chloride has a molecular weight of 217.09 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-propylbenzoyl chloride is sourced from PubChem (CID 141018159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).