About (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin
(5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin (PubChem CID 141019175) has the molecular formula C21H34N2OS2Sn
and a molecular weight of 513.36 g/mol. Its IUPAC name is (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin.
Molecular Properties
| Compound Name | (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin |
| PubChem CID | 141019175 |
| Molecular Formula | C21H34N2OS2Sn |
| Molecular Weight | 513.36 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cn2c(C(C)=O)nc(SC)c2s1 |
| InChI | InChI=1S/C13H27.C8H7N2OS2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(11)6-9-7(12-2)8-10(6)3-4-13-8;/h4-12H2,1-3H3;3H,1-2H3; |
| InChIKey | YQQCJZBVEHZSRZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.36 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin?
The IUPAC name of (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin (CID 141019175) is (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin.
What is the SMILES notation for (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin?
The canonical SMILES for (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin is CCCCC(CCCC)(CCCC)[Sn]c1cn2c(C(C)=O)nc(SC)c2s1.
What is the InChIKey of (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin?
The InChIKey is YQQCJZBVEHZSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C8H7N2OS2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(11)6-9-7(12-2)8-10(6)3-4-13-8;/h4-12H2,1-3H3;3H,1-2H3;.
What are the key properties of (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin?
(5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin has a molecular weight of 513.36 g/mol, XLogP of 6.38, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyl-7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-(5-butylnonan-5-yl)tin is sourced from PubChem (CID 141019175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).