About 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin
5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin (PubChem CID 141019209) has the molecular formula C20H34N2S2Sn
and a molecular weight of 485.35 g/mol. Its IUPAC name is 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin |
| PubChem CID | 141019209 |
| Molecular Formula | C20H34N2S2Sn |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cn2cnc(SCC)c2s1 |
| InChI | InChI=1S/C13H27.C7H7N2S2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-10-6-7-9(5-8-6)3-4-11-7;/h4-12H2,1-3H3;3,5H,2H2,1H3; |
| InChIKey | QWTXKKVVOOAFHB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin?
The IUPAC name of 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin (CID 141019209) is 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin.
What is the SMILES notation for 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin?
The canonical SMILES for 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin is CCCCC(CCCC)(CCCC)[Sn]c1cn2cnc(SCC)c2s1.
What is the InChIKey of 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin?
The InChIKey is QWTXKKVVOOAFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C7H7N2S2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-10-6-7-9(5-8-6)3-4-11-7;/h4-12H2,1-3H3;3,5H,2H2,1H3;.
What are the key properties of 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin?
5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin has a molecular weight of 485.35 g/mol, XLogP of 6.57, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-(7-ethylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)tin is sourced from PubChem (CID 141019209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).