C11H13BrO — CID 141019328
7-bromo-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one (PubChem CID 141019328) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is 7-bromo-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one.
| Compound Name | 7-bromo-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one |
|---|---|
| PubChem CID | 141019328 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 7-bromo-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one |
| SMILES | O=C1CC=CC2=C1CCC(Br)CC2 |
| InChI | InChI=1S/C11H13BrO/c12-9-5-4-8-2-1-3-11(13)10(8)7-6-9/h1-2,9H,3-7H2 |
| InChIKey | LSPKGFPWCSDHNY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|