C14H18N2O2 — CID 141019663
(2S,4R)-4-amino-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylic acid (PubChem CID 141019663) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2S,4R)-4-amino-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylic acid.
| Compound Name | (2S,4R)-4-amino-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 141019663 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2S,4R)-4-amino-2-methyl-2,3,4,6,7,8-hexahydrocyclopenta[g]quinoline-1-carboxylic acid |
| SMILES | C[C@H]1C[C@@H](N)c2cc3c(cc2N1C(=O)O)CCC3 |
| InChI | InChI=1S/C14H18N2O2/c1-8-5-12(15)11-6-9-3-2-4-10(9)7-13(11)16(8)14(17)18/h6-8,12H,2-5,15H2,1H3,(H,17,18)/t8-,12+/m0/s1 |
| InChIKey | RXXVFLBZJDCTCW-QPUJVOFHSA-N |
| XLogP | 2.45 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |