About N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide
N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 141019859) has the molecular formula C16H19F3N4O
and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 141019859 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(N2CC(C)NCC2C)ccc(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O/c1-9-8-23(10(2)7-21-9)13-5-4-12(6-20)14(16(17,18)19)15(13)22-11(3)24/h4-5,9-10,21H,7-8H2,1-3H3,(H,22,24) |
| InChIKey | JTOLCLIEIRRZGN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide (CID 141019859) is N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide is CC(=O)Nc1c(N2CC(C)NCC2C)ccc(C#N)c1C(F)(F)F.
What is the InChIKey of N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide?
The InChIKey is JTOLCLIEIRRZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3N4O/c1-9-8-23(10(2)7-21-9)13-5-4-12(6-20)14(16(17,18)19)15(13)22-11(3)24/h4-5,9-10,21H,7-8H2,1-3H3,(H,22,24).
What are the key properties of N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide?
N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide has a molecular weight of 340.35 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-cyano-6-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 141019859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).