C22H33NO5 — CID 141020106
2-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]oxy-2-oxoacetic acid (PubChem CID 141020106) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]oxy-2-oxoacetic acid.
| Compound Name | 2-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]oxy-2-oxoacetic acid |
|---|---|
| PubChem CID | 141020106 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-[2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-yl]oxy-2-oxoacetic acid |
| SMILES | CCC1(C)CC(OC(=O)C(=O)O)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C22H33NO5/c1-7-21(5)14-18(27-20(26)19(24)25)15(3)22(6,8-2)23(21)28-16(4)17-12-10-9-11-13-17/h9-13,15-16,18H,7-8,14H2,1-6H3,(H,24,25) |
| InChIKey | NIWCQBLTZGQPEV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|