C15H22N4O2 — CID 141020629
3-methyl-1-(methylcarbamoyl)-1-(2-piperidin-4-ylphenyl)urea (PubChem CID 141020629) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-methyl-1-(methylcarbamoyl)-1-(2-piperidin-4-ylphenyl)urea.
| Compound Name | 3-methyl-1-(methylcarbamoyl)-1-(2-piperidin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 141020629 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-methyl-1-(methylcarbamoyl)-1-(2-piperidin-4-ylphenyl)urea |
| SMILES | CNC(=O)N(C(=O)NC)c1ccccc1C1CCNCC1 |
| InChI | InChI=1S/C15H22N4O2/c1-16-14(20)19(15(21)17-2)13-6-4-3-5-12(13)11-7-9-18-10-8-11/h3-6,11,18H,7-10H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | ZHNBLKZSWGIDCO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |