About (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate
(3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 141020964) has the molecular formula C13H12O5S
and a molecular weight of 280.30 g/mol. Its IUPAC name is (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 141020964 |
| Molecular Formula | C13H12O5S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | O=C1C=C(OC(=O)C2C=CC=CC2=S(=O)=O)CCC1 |
| InChI | InChI=1S/C13H12O5S/c14-9-4-3-5-10(8-9)18-13(15)11-6-1-2-7-12(11)19(16)17/h1-2,6-8,11H,3-5H2 |
| InChIKey | DCAKMAMANLAWES-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate (CID 141020964) is (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate is O=C1C=C(OC(=O)C2C=CC=CC2=S(=O)=O)CCC1.
What is the InChIKey of (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is DCAKMAMANLAWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5S/c14-9-4-3-5-10(8-9)18-13(15)11-6-1-2-7-12(11)19(16)17/h1-2,6-8,11H,3-5H2.
What are the key properties of (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate?
(3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 280.30 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclohexen-1-yl) 6-sulfonylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 141020964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).