About oct-1-en-3-amine
oct-1-en-3-amine (PubChem CID 14102130) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is oct-1-en-3-amine.
Molecular Properties
| Compound Name | oct-1-en-3-amine |
| PubChem CID | 14102130 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | oct-1-en-3-amine |
| SMILES | C=CC(N)CCCCC |
| InChI | InChI=1S/C8H17N/c1-3-5-6-7-8(9)4-2/h4,8H,2-3,5-7,9H2,1H3 |
| InChIKey | RJWDQEOJSUBQLJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-en-3-amine?
The IUPAC name of oct-1-en-3-amine (CID 14102130) is oct-1-en-3-amine.
What is the SMILES notation for oct-1-en-3-amine?
The canonical SMILES for oct-1-en-3-amine is C=CC(N)CCCCC.
What is the InChIKey of oct-1-en-3-amine?
The InChIKey is RJWDQEOJSUBQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-3-5-6-7-8(9)4-2/h4,8H,2-3,5-7,9H2,1H3.
What are the key properties of oct-1-en-3-amine?
oct-1-en-3-amine has a molecular weight of 127.23 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-en-3-amine is sourced from PubChem (CID 14102130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).