C9H10O9 — CID 141021336
2,2,6-trihydroxy-1-methyl-3,9,10-trioxabicyclo[4.3.2]undecane-4,8,11-trione (PubChem CID 141021336) has the molecular formula C9H10O9 and a molecular weight of 262.17 g/mol. Its IUPAC name is 2,2,6-trihydroxy-1-methyl-3,9,10-trioxabicyclo[4.3.2]undecane-4,8,11-trione.
| Compound Name | 2,2,6-trihydroxy-1-methyl-3,9,10-trioxabicyclo[4.3.2]undecane-4,8,11-trione |
|---|---|
| PubChem CID | 141021336 |
| Molecular Formula | C9H10O9 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2,2,6-trihydroxy-1-methyl-3,9,10-trioxabicyclo[4.3.2]undecane-4,8,11-trione |
| SMILES | CC12OC(=O)CC(O)(CC(=O)OC1(O)O)C(=O)O2 |
| InChI | InChI=1S/C9H10O9/c1-7-9(14,15)17-5(11)3-8(13,6(12)18-7)2-4(10)16-7/h13-15H,2-3H2,1H3 |
| InChIKey | UUYAEUVWKXRCHE-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|