About 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole
6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole (PubChem CID 141021506) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
Molecular Properties
| Compound Name | 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| PubChem CID | 141021506 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| SMILES | CSc1ccc2c(c1)cc1n2CCC1 |
| InChI | InChI=1S/C12H13NS/c1-14-11-4-5-12-9(8-11)7-10-3-2-6-13(10)12/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | CKLDMNLZPMHHEK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
The IUPAC name of 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole (CID 141021506) is 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
What is the SMILES notation for 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
The canonical SMILES for 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole is CSc1ccc2c(c1)cc1n2CCC1.
What is the InChIKey of 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
The InChIKey is CKLDMNLZPMHHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS/c1-14-11-4-5-12-9(8-11)7-10-3-2-6-13(10)12/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole?
6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole has a molecular weight of 203.31 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole is sourced from PubChem (CID 141021506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).