About 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol
1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol (PubChem CID 141021519) has the molecular formula C12H26S6
and a molecular weight of 362.74 g/mol. Its IUPAC name is 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol.
Molecular Properties
| Compound Name | 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol |
| PubChem CID | 141021519 |
| Molecular Formula | C12H26S6 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol |
| SMILES | CCC(S)SCC(C)(SC(S)CC)SC(S)CC |
| InChI | InChI=1S/C12H26S6/c1-5-9(13)16-8-12(4,17-10(14)6-2)18-11(15)7-3/h9-11,13-15H,5-8H2,1-4H3 |
| InChIKey | GDPRYAXNHGXHSY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol?
The IUPAC name of 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol (CID 141021519) is 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol.
What is the SMILES notation for 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol?
The canonical SMILES for 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol is CCC(S)SCC(C)(SC(S)CC)SC(S)CC.
What is the InChIKey of 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol?
The InChIKey is GDPRYAXNHGXHSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26S6/c1-5-9(13)16-8-12(4,17-10(14)6-2)18-11(15)7-3/h9-11,13-15H,5-8H2,1-4H3.
What are the key properties of 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol?
1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol has a molecular weight of 362.74 g/mol, XLogP of 5.90, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis(1-sulfanylpropylsulfanyl)propylsulfanyl]propane-1-thiol is sourced from PubChem (CID 141021519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).