About 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol
4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol (PubChem CID 141021566) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol |
| PubChem CID | 141021566 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol |
| SMILES | CC1=C(CN)C=CNC1O |
| InChI | InChI=1S/C7H12N2O/c1-5-6(4-8)2-3-9-7(5)10/h2-3,7,9-10H,4,8H2,1H3 |
| InChIKey | UYDMXHRIVAJXCZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol?
The IUPAC name of 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol (CID 141021566) is 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol?
The canonical SMILES for 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol is CC1=C(CN)C=CNC1O.
What is the InChIKey of 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol?
The InChIKey is UYDMXHRIVAJXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5-6(4-8)2-3-9-7(5)10/h2-3,7,9-10H,4,8H2,1H3.
What are the key properties of 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol?
4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol has a molecular weight of 140.19 g/mol, XLogP of -0.30, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3-methyl-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 141021566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).