C21H24Cl2N2 — CID 141021606
5-[2-(1-adamantyl)ethyl]-2-(2,3-dichlorophenyl)-1H-imidazole (PubChem CID 141021606) has the molecular formula C21H24Cl2N2 and a molecular weight of 375.34 g/mol. Its IUPAC name is 5-[2-(1-adamantyl)ethyl]-2-(2,3-dichlorophenyl)-1H-imidazole.
| Compound Name | 5-[2-(1-adamantyl)ethyl]-2-(2,3-dichlorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 141021606 |
| Molecular Formula | C21H24Cl2N2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-[2-(1-adamantyl)ethyl]-2-(2,3-dichlorophenyl)-1H-imidazole |
| SMILES | Clc1cccc(-c2ncc(CCC34CC5CC(CC(C5)C3)C4)[nH]2)c1Cl |
| InChI | InChI=1S/C21H24Cl2N2/c22-18-3-1-2-17(19(18)23)20-24-12-16(25-20)4-5-21-9-13-6-14(10-21)8-15(7-13)11-21/h1-3,12-15H,4-11H2,(H,24,25) |
| InChIKey | ICMIVSSHRODAAI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |