C31H50O5 — CID 141021771
[(6R)-1-acetyloxy-6-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptyl] acetate (PubChem CID 141021771) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is [(6R)-1-acetyloxy-6-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptyl] acetate.
| Compound Name | [(6R)-1-acetyloxy-6-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptyl] acetate |
|---|---|
| PubChem CID | 141021771 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | [(6R)-1-acetyloxy-6-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)C(C)C(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H50O5/c1-19(10-15-28(34)20(2)29(35-21(3)32)36-22(4)33)25-13-14-26-24-12-11-23-9-7-8-17-30(23,5)27(24)16-18-31(25,26)6/h19-20,23-27,29H,7-18H2,1-6H3/t19-,20?,23+,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChIKey | DNAAREFIMZGBBV-FBOYEVOLSA-N |
| XLogP | 7.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|