About 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan
3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan (PubChem CID 141022035) has the molecular formula C12H19O2PS2
and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan.
Molecular Properties
| Compound Name | 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan |
| PubChem CID | 141022035 |
| Molecular Formula | C12H19O2PS2 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan |
| SMILES | CCP(=O)(CC)c1ccoc1C1SCCCS1 |
| InChI | InChI=1S/C12H19O2PS2/c1-3-15(13,4-2)10-6-7-14-11(10)12-16-8-5-9-17-12/h6-7,12H,3-5,8-9H2,1-2H3 |
| InChIKey | KGLUOTLRDWTSEC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan?
The IUPAC name of 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan (CID 141022035) is 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan.
What is the SMILES notation for 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan?
The canonical SMILES for 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan is CCP(=O)(CC)c1ccoc1C1SCCCS1.
What is the InChIKey of 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan?
The InChIKey is KGLUOTLRDWTSEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O2PS2/c1-3-15(13,4-2)10-6-7-14-11(10)12-16-8-5-9-17-12/h6-7,12H,3-5,8-9H2,1-2H3.
What are the key properties of 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan?
3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan has a molecular weight of 290.39 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethylphosphoryl-2-(1,3-dithian-2-yl)furan is sourced from PubChem (CID 141022035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).