About [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate
[2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate (PubChem CID 141022063) has the molecular formula C11H8N3O2PS2
and a molecular weight of 309.31 g/mol. Its IUPAC name is [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate.
Molecular Properties
| Compound Name | [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate |
| PubChem CID | 141022063 |
| Molecular Formula | C11H8N3O2PS2 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate |
| SMILES | CCc1c(SC#N)cc(OC#P=O)c2nc(N)sc12 |
| InChI | InChI=1S/C11H8N3O2PS2/c1-2-6-8(18-4-12)3-7(16-5-17-15)9-10(6)19-11(13)14-9/h3H,2H2,1H3,(H2,13,14) |
| InChIKey | QEBOXAULFXKPTO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate?
The IUPAC name of [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate (CID 141022063) is [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate.
What is the SMILES notation for [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate?
The canonical SMILES for [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate is CCc1c(SC#N)cc(OC#P=O)c2nc(N)sc12.
What is the InChIKey of [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate?
The InChIKey is QEBOXAULFXKPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N3O2PS2/c1-2-6-8(18-4-12)3-7(16-5-17-15)9-10(6)19-11(13)14-9/h3H,2H2,1H3,(H2,13,14).
What are the key properties of [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate?
[2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate has a molecular weight of 309.31 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-7-ethyl-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate is sourced from PubChem (CID 141022063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).