About (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate
(3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate (PubChem CID 141023017) has the molecular formula C15H18BrClO3P-
and a molecular weight of 392.64 g/mol. Its IUPAC name is (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate.
Molecular Properties
| Compound Name | (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate |
| PubChem CID | 141023017 |
| Molecular Formula | C15H18BrClO3P- |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate |
| SMILES | COc1c(Cl)cc(Br)c(OC)c1/C([O-])=P/C1CCCCC1 |
| InChI | InChI=1S/C15H19BrClO3P/c1-19-13-10(16)8-11(17)14(20-2)12(13)15(18)21-9-6-4-3-5-7-9/h8-9,18H,3-7H2,1-2H3/p-1 |
| InChIKey | RZXZJFOMRDDLOM-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate?
The IUPAC name of (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate (CID 141023017) is (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate.
What is the SMILES notation for (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate?
The canonical SMILES for (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate is COc1c(Cl)cc(Br)c(OC)c1/C([O-])=P/C1CCCCC1.
What is the InChIKey of (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate?
The InChIKey is RZXZJFOMRDDLOM-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H19BrClO3P/c1-19-13-10(16)8-11(17)14(20-2)12(13)15(18)21-9-6-4-3-5-7-9/h8-9,18H,3-7H2,1-2H3/p-1.
What are the key properties of (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate?
(3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate has a molecular weight of 392.64 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-5-chloro-2,6-dimethoxyphenyl)-cyclohexylphosphanylidenemethanolate is sourced from PubChem (CID 141023017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).