C19H30OP- — CID 141023143
(2,6-diethylphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate (PubChem CID 141023143) has the molecular formula C19H30OP- and a molecular weight of 305.42 g/mol. Its IUPAC name is (2,6-diethylphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate.
| Compound Name | (2,6-diethylphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate |
|---|---|
| PubChem CID | 141023143 |
| Molecular Formula | C19H30OP- |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2,6-diethylphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate |
| SMILES | CCc1cccc(CC)c1/C([O-])=P/CC(C)CC(C)(C)C |
| InChI | InChI=1S/C19H31OP/c1-7-15-10-9-11-16(8-2)17(15)18(20)21-13-14(3)12-19(4,5)6/h9-11,14,20H,7-8,12-13H2,1-6H3/p-1 |
| InChIKey | VTDXJOPDJOKHQZ-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|