C11H10Cl4OP- — CID 141023153
[5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide (PubChem CID 141023153) has the molecular formula C11H10Cl4OP- and a molecular weight of 330.99 g/mol. Its IUPAC name is [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide.
| Compound Name | [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide |
|---|---|
| PubChem CID | 141023153 |
| Molecular Formula | C11H10Cl4OP- |
| Molecular Weight | 330.99 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide |
| SMILES | O=C(CCCC[PH-])c1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl4OP/c12-6-5-7(13)11(15)9(10(6)14)8(16)3-1-2-4-17/h5,17H,1-4H2/q-1 |
| InChIKey | DQGXEYUTDHSZHJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.99 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|