About [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide
[5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide (PubChem CID 141023153) has the molecular formula C11H10Cl4OP-
and a molecular weight of 330.99 g/mol. Its IUPAC name is [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide.
Molecular Properties
| Compound Name | [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide |
| PubChem CID | 141023153 |
| Molecular Formula | C11H10Cl4OP- |
| Molecular Weight | 330.99 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide |
| SMILES | O=C(CCCC[PH-])c1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl4OP/c12-6-5-7(13)11(15)9(10(6)14)8(16)3-1-2-4-17/h5,17H,1-4H2/q-1 |
| InChIKey | DQGXEYUTDHSZHJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.99 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide?
The IUPAC name of [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide (CID 141023153) is [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide.
What is the SMILES notation for [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide?
The canonical SMILES for [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide is O=C(CCCC[PH-])c1c(Cl)c(Cl)cc(Cl)c1Cl.
What is the InChIKey of [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide?
The InChIKey is DQGXEYUTDHSZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl4OP/c12-6-5-7(13)11(15)9(10(6)14)8(16)3-1-2-4-17/h5,17H,1-4H2/q-1.
What are the key properties of [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide?
[5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide has a molecular weight of 330.99 g/mol, XLogP of 5.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-5-(2,3,5,6-tetrachlorophenyl)pentyl]phosphanide is sourced from PubChem (CID 141023153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).