C13H23N5 — CID 141023306
6-(1-cyclohexylethyl)-2-N-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 141023306) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 6-(1-cyclohexylethyl)-2-N-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-cyclohexylethyl)-2-N-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 141023306 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 6-(1-cyclohexylethyl)-2-N-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(N)nc(C(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N5/c1-3-15-13-17-11(16-12(14)18-13)9(2)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | RVLSGPLZHBIIFQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |