C14H9N3OS2 — CID 141023326
2-[3-(furan-2-yl)-4-thiophen-2-yl-1H-pyrazol-5-yl]-1,3-thiazole (PubChem CID 141023326) has the molecular formula C14H9N3OS2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-4-thiophen-2-yl-1H-pyrazol-5-yl]-1,3-thiazole.
| Compound Name | 2-[3-(furan-2-yl)-4-thiophen-2-yl-1H-pyrazol-5-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 141023326 |
| Molecular Formula | C14H9N3OS2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-[3-(furan-2-yl)-4-thiophen-2-yl-1H-pyrazol-5-yl]-1,3-thiazole |
| SMILES | c1coc(-c2n[nH]c(-c3nccs3)c2-c2cccs2)c1 |
| InChI | InChI=1S/C14H9N3OS2/c1-3-9(18-6-1)12-11(10-4-2-7-19-10)13(17-16-12)14-15-5-8-20-14/h1-8H,(H,16,17) |
| InChIKey | KLVUYGNPECMODJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |