C14H12IN3O3 — CID 141023689
(3Z)-4-iodo-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-nitro-1,2-dihydroindole (PubChem CID 141023689) has the molecular formula C14H12IN3O3 and a molecular weight of 397.17 g/mol. Its IUPAC name is (3Z)-4-iodo-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-nitro-1,2-dihydroindole.
| Compound Name | (3Z)-4-iodo-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-nitro-1,2-dihydroindole |
|---|---|
| PubChem CID | 141023689 |
| Molecular Formula | C14H12IN3O3 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | (3Z)-4-iodo-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-nitro-1,2-dihydroindole |
| SMILES | COc1cc[nH]c1/C=C1\CNc2ccc([N+](=O)[O-])c(I)c21 |
| InChI | InChI=1S/C14H12IN3O3/c1-21-12-4-5-16-10(12)6-8-7-17-9-2-3-11(18(19)20)14(15)13(8)9/h2-6,16-17H,7H2,1H3/b8-6+ |
| InChIKey | YSABMCKIXNBFQQ-SOFGYWHQSA-N |
| XLogP | 3.50 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|