C21H17ClFN3O3 — CID 141024299
N-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-2-fluorobenzamide (PubChem CID 141024299) has the molecular formula C21H17ClFN3O3 and a molecular weight of 413.84 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 141024299 |
| Molecular Formula | C21H17ClFN3O3 |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-2-fluorobenzamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1ccc(NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H17ClFN3O3/c1-29-19-11-6-13(22)12-18(19)26-21(28)25-15-9-7-14(8-10-15)24-20(27)16-4-2-3-5-17(16)23/h2-12H,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | RFXMQHBBPIVQKX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |