About 2H-cyclopenta[g][1,3]benzoxazole
2H-cyclopenta[g][1,3]benzoxazole (PubChem CID 141024625) has the molecular formula C10H7NO
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2H-cyclopenta[g][1,3]benzoxazole.
Molecular Properties
| Compound Name | 2H-cyclopenta[g][1,3]benzoxazole |
| PubChem CID | 141024625 |
| Molecular Formula | C10H7NO |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2H-cyclopenta[g][1,3]benzoxazole |
| SMILES | C1=Cc2c3c(ccc2=C1)=NCO3 |
| InChI | InChI=1S/C10H7NO/c1-2-7-4-5-9-10(8(7)3-1)12-6-11-9/h1-5H,6H2 |
| InChIKey | LNVWOEDKCUSDQN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-cyclopenta[g][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-cyclopenta[g][1,3]benzoxazole?
The IUPAC name of 2H-cyclopenta[g][1,3]benzoxazole (CID 141024625) is 2H-cyclopenta[g][1,3]benzoxazole.
What is the SMILES notation for 2H-cyclopenta[g][1,3]benzoxazole?
The canonical SMILES for 2H-cyclopenta[g][1,3]benzoxazole is C1=Cc2c3c(ccc2=C1)=NCO3.
What is the InChIKey of 2H-cyclopenta[g][1,3]benzoxazole?
The InChIKey is LNVWOEDKCUSDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO/c1-2-7-4-5-9-10(8(7)3-1)12-6-11-9/h1-5H,6H2.
What are the key properties of 2H-cyclopenta[g][1,3]benzoxazole?
2H-cyclopenta[g][1,3]benzoxazole has a molecular weight of 157.17 g/mol, XLogP of 0.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-cyclopenta[g][1,3]benzoxazole is sourced from PubChem (CID 141024625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).