C14H17F4N2O8P — CID 14102524
[(2R,3S,5R)-2-[[fluoro(2,2,2-trifluoroethoxy)phosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 14102524) has the molecular formula C14H17F4N2O8P and a molecular weight of 448.26 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[fluoro(2,2,2-trifluoroethoxy)phosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2-[[fluoro(2,2,2-trifluoroethoxy)phosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 14102524 |
| Molecular Formula | C14H17F4N2O8P |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | [(2R,3S,5R)-2-[[fluoro(2,2,2-trifluoroethoxy)phosphoryl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(F)OCC(F)(F)F |
| InChI | InChI=1S/C14H17F4N2O8P/c1-7-4-20(13(23)19-12(7)22)11-3-9(27-8(2)21)10(28-11)5-25-29(18,24)26-6-14(15,16)17/h4,9-11H,3,5-6H2,1-2H3,(H,19,22,23)/t9-,10+,11+,29?/m0/s1 |
| InChIKey | MSVMHGYRJSPOJV-WEXAVNANSA-N |
| XLogP | 1.74 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|