C25H24N4O4 — CID 141025466
7-(1H-indol-4-yl)-10-[3-(1H-indol-3-yl)propyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione (PubChem CID 141025466) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 7-(1H-indol-4-yl)-10-[3-(1H-indol-3-yl)propyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione.
| Compound Name | 7-(1H-indol-4-yl)-10-[3-(1H-indol-3-yl)propyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 141025466 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 7-(1H-indol-4-yl)-10-[3-(1H-indol-3-yl)propyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
| SMILES | O=C1OC2(CN(c3cccc4[nH]ccc34)CCN2CCCc2c[nH]c3ccccc23)OC1=O |
| InChI | InChI=1S/C25H24N4O4/c30-23-24(31)33-25(32-23)16-28(22-9-3-8-21-19(22)10-11-26-21)13-14-29(25)12-4-5-17-15-27-20-7-2-1-6-18(17)20/h1-3,6-11,15,26-27H,4-5,12-14,16H2 |
| InChIKey | IZKUFCWPWUPTSC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|