C26H26N4O4 — CID 141025467
7-(1H-indol-4-yl)-10-[4-(1H-indol-3-yl)butyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione (PubChem CID 141025467) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 7-(1H-indol-4-yl)-10-[4-(1H-indol-3-yl)butyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione.
| Compound Name | 7-(1H-indol-4-yl)-10-[4-(1H-indol-3-yl)butyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 141025467 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 7-(1H-indol-4-yl)-10-[4-(1H-indol-3-yl)butyl]-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
| SMILES | O=C1OC2(CN(c3cccc4[nH]ccc34)CCN2CCCCc2c[nH]c3ccccc23)OC1=O |
| InChI | InChI=1S/C26H26N4O4/c31-24-25(32)34-26(33-24)17-29(23-10-5-9-22-20(23)11-12-27-22)14-15-30(26)13-4-3-6-18-16-28-21-8-2-1-7-19(18)21/h1-2,5,7-12,16,27-28H,3-4,6,13-15,17H2 |
| InChIKey | RIDQAAXGORCKSV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|