C24H21ClN4O4 — CID 141025474
10-[2-(4-chloro-1H-indol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione (PubChem CID 141025474) has the molecular formula C24H21ClN4O4 and a molecular weight of 464.91 g/mol. Its IUPAC name is 10-[2-(4-chloro-1H-indol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione.
| Compound Name | 10-[2-(4-chloro-1H-indol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 141025474 |
| Molecular Formula | C24H21ClN4O4 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 10-[2-(4-chloro-1H-indol-3-yl)ethyl]-7-(1H-indol-4-yl)-1,4-dioxa-7,10-diazaspiro[4.5]decane-2,3-dione |
| SMILES | O=C1OC2(CN(c3cccc4[nH]ccc34)CCN2CCc2c[nH]c3cccc(Cl)c23)OC1=O |
| InChI | InChI=1S/C24H21ClN4O4/c25-17-3-1-5-19-21(17)15(13-27-19)8-10-29-12-11-28(14-24(29)32-22(30)23(31)33-24)20-6-2-4-18-16(20)7-9-26-18/h1-7,9,13,26-27H,8,10-12,14H2 |
| InChIKey | SBSMBVSKWSOIPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|