C22H20N2O6 — CID 141026049
N-[3-(10-methyl-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decane-7-carbonyl)phenyl]benzamide (PubChem CID 141026049) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is N-[3-(10-methyl-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decane-7-carbonyl)phenyl]benzamide.
| Compound Name | N-[3-(10-methyl-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decane-7-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 141026049 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[3-(10-methyl-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decane-7-carbonyl)phenyl]benzamide |
| SMILES | CN1CCC(C(=O)c2cccc(NC(=O)c3ccccc3)c2)CC12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C22H20N2O6/c1-24-11-10-16(13-22(24)29-20(27)21(28)30-22)18(25)15-8-5-9-17(12-15)23-19(26)14-6-3-2-4-7-14/h2-9,12,16H,10-11,13H2,1H3,(H,23,26) |
| InChIKey | SLVUFUUZGLGZNC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|