C22H17ClO2 — CID 141026509
1-(4-chlorophenyl)-2-[(4-ethynylphenoxy)methyl]-4-methoxybenzene (PubChem CID 141026509) has the molecular formula C22H17ClO2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(4-ethynylphenoxy)methyl]-4-methoxybenzene.
| Compound Name | 1-(4-chlorophenyl)-2-[(4-ethynylphenoxy)methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 141026509 |
| Molecular Formula | C22H17ClO2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(4-ethynylphenoxy)methyl]-4-methoxybenzene |
| SMILES | C#Cc1ccc(OCc2cc(OC)ccc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17ClO2/c1-3-16-4-10-20(11-5-16)25-15-18-14-21(24-2)12-13-22(18)17-6-8-19(23)9-7-17/h1,4-14H,15H2,2H3 |
| InChIKey | RLGRHJCXGQPVGF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|